ChemNet > CAS > 499769-97-0 1-biphenylenylboronic acid
499769-97-0 1-biphenylenylboronic acid
| Nama produk |
1-biphenylenylboronic acid |
| Sinonim |
biphenylen-1-ylboronic acid |
| MF |
C12H9BO2 |
| Berat Molekul |
196.0097 |
| InChI |
InChI=1/C12H9BO2/c14-13(15)11-7-3-6-10-8-4-1-2-5-9(8)12(10)11/h1-7,14-15H |
| CAS NO |
499769-97-0 |
| Struktur Molekul |
|
| Kepadatan |
1.31g/cm3 |
| Titik lebur |
250℃ |
| Titik didih |
415.4°C at 760 mmHg |
| Indeks bias |
1.751 |
| Titik nyala |
205°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
